C16H27Cl2N3OS — CID 22884085
[4-[(2R)-2-amino-3-sulfanylpropyl]piperazin-1-yl]-(2,3-dimethylphenyl)methanone;dihydrochloride (PubChem CID 22884085) has the molecular formula C16H27Cl2N3OS and a molecular weight of 380.39 g/mol. Its IUPAC name is [4-[(2R)-2-amino-3-sulfanylpropyl]piperazin-1-yl]-(2,3-dimethylphenyl)methanone;dihydrochloride.
| Compound Name | [4-[(2R)-2-amino-3-sulfanylpropyl]piperazin-1-yl]-(2,3-dimethylphenyl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 22884085 |
| Molecular Formula | C16H27Cl2N3OS |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [4-[(2R)-2-amino-3-sulfanylpropyl]piperazin-1-yl]-(2,3-dimethylphenyl)methanone;dihydrochloride |
| SMILES | Cc1cccc(C(=O)N2CCN(C[C@@H](N)CS)CC2)c1C.Cl.Cl |
| InChI | InChI=1S/C16H25N3OS.2ClH/c1-12-4-3-5-15(13(12)2)16(20)19-8-6-18(7-9-19)10-14(17)11-21;;/h3-5,14,21H,6-11,17H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | VBTNJNKFOAIKMP-FMOMHUKBSA-N |
| XLogP | 2.16 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|