C9H13F3 — CID 22886878
1-methyl-4-(1,2,2-trifluoroethenyl)cyclohexane (PubChem CID 22886878) has the molecular formula C9H13F3 and a molecular weight of 178.20 g/mol. Its IUPAC name is 1-methyl-4-(1,2,2-trifluoroethenyl)cyclohexane.
| Compound Name | 1-methyl-4-(1,2,2-trifluoroethenyl)cyclohexane |
|---|---|
| PubChem CID | 22886878 |
| Molecular Formula | C9H13F3 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 1-methyl-4-(1,2,2-trifluoroethenyl)cyclohexane |
| SMILES | CC1CCC(C(F)=C(F)F)CC1 |
| InChI | InChI=1S/C9H13F3/c1-6-2-4-7(5-3-6)8(10)9(11)12/h6-7H,2-5H2,1H3 |
| InChIKey | VNRYWQIOORGESD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |