C9H11NO3 — CID 22886929
1-(3-oxopentyl)pyrrole-2,5-dione (PubChem CID 22886929) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-(3-oxopentyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-oxopentyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 22886929 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1-(3-oxopentyl)pyrrole-2,5-dione |
| SMILES | CCC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H11NO3/c1-2-7(11)5-6-10-8(12)3-4-9(10)13/h3-4H,2,5-6H2,1H3 |
| InChIKey | JMDWAOREMHCHOV-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|