C9H12FNO2 — CID 125475529
1-[(3S)-3-fluoropentyl]pyrrole-2,5-dione (PubChem CID 125475529) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 1-[(3S)-3-fluoropentyl]pyrrole-2,5-dione.
| Compound Name | 1-[(3S)-3-fluoropentyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 125475529 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-[(3S)-3-fluoropentyl]pyrrole-2,5-dione |
| SMILES | CC[C@H](F)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H12FNO2/c1-2-7(10)5-6-11-8(12)3-4-9(11)13/h3-4,7H,2,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | NASVSDURBUSAKR-ZETCQYMHSA-N |
| XLogP | 1.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|