C12H19NO5 — CID 57301916
1-(3-tert-butylperoxy-3-methoxypropyl)pyrrole-2,5-dione (PubChem CID 57301916) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-(3-tert-butylperoxy-3-methoxypropyl)pyrrole-2,5-dione.
| Compound Name | 1-(3-tert-butylperoxy-3-methoxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57301916 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-(3-tert-butylperoxy-3-methoxypropyl)pyrrole-2,5-dione |
| SMILES | COC(CCN1C(=O)C=CC1=O)OOC(C)(C)C |
| InChI | InChI=1S/C12H19NO5/c1-12(2,3)18-17-11(16-4)7-8-13-9(14)5-6-10(13)15/h5-6,11H,7-8H2,1-4H3 |
| InChIKey | KZOGQMFAGMEGBR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|