C18H30N2O7 — CID 59993756
N-(2,2-dimethoxyethyl)-4-[2-[4-(2,5-dioxopyrrol-1-yl)butoxy]ethoxy]butanamide (PubChem CID 59993756) has the molecular formula C18H30N2O7 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-[2-[4-(2,5-dioxopyrrol-1-yl)butoxy]ethoxy]butanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-[2-[4-(2,5-dioxopyrrol-1-yl)butoxy]ethoxy]butanamide |
|---|---|
| PubChem CID | 59993756 |
| Molecular Formula | C18H30N2O7 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-[2-[4-(2,5-dioxopyrrol-1-yl)butoxy]ethoxy]butanamide |
| SMILES | COC(CNC(=O)CCCOCCOCCCCN1C(=O)C=CC1=O)OC |
| InChI | InChI=1S/C18H30N2O7/c1-24-18(25-2)14-19-15(21)6-5-11-27-13-12-26-10-4-3-9-20-16(22)7-8-17(20)23/h7-8,18H,3-6,9-14H2,1-2H3,(H,19,21) |
| InChIKey | LITVAKJNFXXWSZ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|