C7H12O5 — CID 22887066
(3S,4R,5S)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-one (PubChem CID 22887066) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is (3S,4R,5S)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-one.
| Compound Name | (3S,4R,5S)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-one |
|---|---|
| PubChem CID | 22887066 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (3S,4R,5S)-5-(hydroxymethyl)-3,4-dimethoxyoxolan-2-one |
| SMILES | CO[C@@H]1[C@H](CO)OC(=O)[C@H]1OC |
| InChI | InChI=1S/C7H12O5/c1-10-5-4(3-8)12-7(9)6(5)11-2/h4-6,8H,3H2,1-2H3/t4-,5+,6-/m0/s1 |
| InChIKey | MCTUKQDBUNSXPS-JKUQZMGJSA-N |
| XLogP | -1.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |