C15H20N4O3S — CID 22887934
(2S)-2-amino-N-(3-butoxy-1,2,4-thiadiazol-5-yl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 22887934) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-butoxy-1,2,4-thiadiazol-5-yl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(3-butoxy-1,2,4-thiadiazol-5-yl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 22887934 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2S)-2-amino-N-(3-butoxy-1,2,4-thiadiazol-5-yl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | CCCCOc1nsc(NC(=O)[C@@H](N)Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C15H20N4O3S/c1-2-3-8-22-14-18-15(23-19-14)17-13(21)12(16)9-10-4-6-11(20)7-5-10/h4-7,12,20H,2-3,8-9,16H2,1H3,(H,17,18,19,21)/t12-/m0/s1 |
| InChIKey | SLRSUECTXFCFRK-LBPRGKRZSA-N |
| XLogP | 1.93 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|