C14H20O4 — CID 22889405
(4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate (PubChem CID 22889405) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate.
| Compound Name | (4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22889405 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1C(O)C(O)CC21 |
| InChI | InChI=1S/C14H20O4/c1-6(2)14(17)18-11-4-7-3-9(11)12-8(7)5-10(15)13(12)16/h7-13,15-16H,1,3-5H2,2H3 |
| InChIKey | MTJUSDMMCDSVTA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|