C16H13ClN6O4 — CID 22889976
N-[4-[2-(4-chloro-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]acetamide (PubChem CID 22889976) has the molecular formula C16H13ClN6O4 and a molecular weight of 388.77 g/mol. Its IUPAC name is N-[4-[2-(4-chloro-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(4-chloro-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 22889976 |
| Molecular Formula | C16H13ClN6O4 |
| Molecular Weight | 388.77 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-[4-[2-(4-chloro-6-nitroindazole-1-carbonyl)hydrazinyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NNC(=O)n2ncc3c(Cl)cc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C16H13ClN6O4/c1-9(24)19-10-2-4-11(5-3-10)20-21-16(25)22-15-7-12(23(26)27)6-14(17)13(15)8-18-22/h2-8,20H,1H3,(H,19,24)(H,21,25) |
| InChIKey | WFNAWFXRBVMJGY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|