C15H13ClN6O5S — CID 22889982
N-[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]methanesulfonamide (PubChem CID 22889982) has the molecular formula C15H13ClN6O5S and a molecular weight of 424.83 g/mol. Its IUPAC name is N-[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 22889982 |
| Molecular Formula | C15H13ClN6O5S |
| Molecular Weight | 424.83 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[4-[2-(6-chloro-4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(NNC(=O)n2ncc3c([N+](=O)[O-])cc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H13ClN6O5S/c1-28(26,27)20-11-4-2-10(3-5-11)18-19-15(23)21-13-6-9(16)7-14(22(24)25)12(13)8-17-21/h2-8,18,20H,1H3,(H,19,23) |
| InChIKey | FZYYBZRLGHIZKR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 148.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|