C36H48N6O6S — CID 22889977
N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-2-octoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide (PubChem CID 22889977) has the molecular formula C36H48N6O6S and a molecular weight of 692.88 g/mol. Its IUPAC name is N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-2-octoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide.
| Compound Name | N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-2-octoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 22889977 |
| Molecular Formula | C36H48N6O6S |
| Molecular Weight | 692.88 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | N-[4-[2-(4-nitroindazole-1-carbonyl)hydrazinyl]phenyl]-2-octoxy-5-(2,4,4-trimethylpentan-2-yl)benzenesulfonamide |
| SMILES | CCCCCCCCOc1ccc(C(C)(C)CC(C)(C)C)cc1S(=O)(=O)Nc1ccc(NNC(=O)n2ncc3c([N+](=O)[O-])cccc32)cc1 |
| InChI | InChI=1S/C36H48N6O6S/c1-7-8-9-10-11-12-22-48-32-21-16-26(36(5,6)25-35(2,3)4)23-33(32)49(46,47)40-28-19-17-27(18-20-28)38-39-34(43)41-30-14-13-15-31(42(44)45)29(30)24-37-41/h13-21,23-24,38,40H,7-12,22,25H2,1-6H3,(H,39,43) |
| InChIKey | QIOSACBGBGYYLY-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 157.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.88 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|