C18H21N3O7S — CID 91704313
N-(4-hexoxyphenyl)-2,5-dinitrobenzenesulfonamide (PubChem CID 91704313) has the molecular formula C18H21N3O7S and a molecular weight of 423.45 g/mol. Its IUPAC name is N-(4-hexoxyphenyl)-2,5-dinitrobenzenesulfonamide.
| Compound Name | N-(4-hexoxyphenyl)-2,5-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 91704313 |
| Molecular Formula | C18H21N3O7S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N-(4-hexoxyphenyl)-2,5-dinitrobenzenesulfonamide |
| SMILES | CCCCCCOc1ccc(NS(=O)(=O)c2cc([N+](=O)[O-])ccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O7S/c1-2-3-4-5-12-28-16-9-6-14(7-10-16)19-29(26,27)18-13-15(20(22)23)8-11-17(18)21(24)25/h6-11,13,19H,2-5,12H2,1H3 |
| InChIKey | SIKHWUYEVJUFSB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|