C25H25NO2 — CID 22891520
N-(2-hydroxy-2-phenylethyl)-9-propylfluorene-9-carboxamide (PubChem CID 22891520) has the molecular formula C25H25NO2 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-(2-hydroxy-2-phenylethyl)-9-propylfluorene-9-carboxamide.
| Compound Name | N-(2-hydroxy-2-phenylethyl)-9-propylfluorene-9-carboxamide |
|---|---|
| PubChem CID | 22891520 |
| Molecular Formula | C25H25NO2 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-(2-hydroxy-2-phenylethyl)-9-propylfluorene-9-carboxamide |
| SMILES | CCCC1(C(=O)NCC(O)c2ccccc2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H25NO2/c1-2-16-25(24(28)26-17-23(27)18-10-4-3-5-11-18)21-14-8-6-12-19(21)20-13-7-9-15-22(20)25/h3-15,23,27H,2,16-17H2,1H3,(H,26,28) |
| InChIKey | MBRIPQSCGUDBBO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |