C12H24N2O2 — CID 22895105
1,8-dihydroxy-2,2,7,7-tetramethyl-3,4,4a,5,6,8a-hexahydro-1,8-naphthyridine (PubChem CID 22895105) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 1,8-dihydroxy-2,2,7,7-tetramethyl-3,4,4a,5,6,8a-hexahydro-1,8-naphthyridine.
| Compound Name | 1,8-dihydroxy-2,2,7,7-tetramethyl-3,4,4a,5,6,8a-hexahydro-1,8-naphthyridine |
|---|---|
| PubChem CID | 22895105 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 1,8-dihydroxy-2,2,7,7-tetramethyl-3,4,4a,5,6,8a-hexahydro-1,8-naphthyridine |
| SMILES | CC1(C)CCC2CCC(C)(C)N(O)C2N1O |
| InChI | InChI=1S/C12H24N2O2/c1-11(2)7-5-9-6-8-12(3,4)14(16)10(9)13(11)15/h9-10,15-16H,5-8H2,1-4H3 |
| InChIKey | RXUVGFQBFLNRIF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |