C39H34FNO4 — CID 22895161
methyl 2-(2-fluorophenyl)-9-methoxy-6-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 22895161) has the molecular formula C39H34FNO4 and a molecular weight of 599.70 g/mol. Its IUPAC name is methyl 2-(2-fluorophenyl)-9-methoxy-6-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-(2-fluorophenyl)-9-methoxy-6-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 22895161 |
| Molecular Formula | C39H34FNO4 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | methyl 2-(2-fluorophenyl)-9-methoxy-6-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1c2c(c3cc(OC)ccc3c1-c1ccccc1)OC(c1ccc(N3CCCCC3)cc1)(c1ccccc1F)C=C2 |
| InChI | InChI=1S/C39H34FNO4/c1-43-29-19-20-30-32(25-29)37-31(36(38(42)44-2)35(30)26-11-5-3-6-12-26)21-22-39(45-37,33-13-7-8-14-34(33)40)27-15-17-28(18-16-27)41-23-9-4-10-24-41/h3,5-8,11-22,25H,4,9-10,23-24H2,1-2H3 |
| InChIKey | MWMLDYQHVMNHDO-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|