C8H16LrNO- — CID 22896089
N-ethyl-2,4-dimethyloxolan-3-amine;lawrencium (PubChem CID 22896089) has the molecular formula C8H16LrNO- and a molecular weight of 404.22 g/mol. Its IUPAC name is N-ethyl-2,4-dimethyloxolan-3-amine;lawrencium.
| Compound Name | N-ethyl-2,4-dimethyloxolan-3-amine;lawrencium |
|---|---|
| PubChem CID | 22896089 |
| Molecular Formula | C8H16LrNO- |
| Molecular Weight | 404.22 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N-ethyl-2,4-dimethyloxolan-3-amine;lawrencium |
| SMILES | C[CH-]NC1C(C)COC1C.[Lr] |
| InChI | InChI=1S/C8H16NO.Lr/c1-4-9-8-6(2)5-10-7(8)3;/h4,6-9H,5H2,1-3H3;/q-1; |
| InChIKey | AVFUNAADQAHRKR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|