About N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide
N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide (PubChem CID 22897375) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide |
| PubChem CID | 22897375 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide |
| SMILES | CCCCCCN(C)C(=O)C1CCCN1C |
| InChI | InChI=1S/C13H26N2O/c1-4-5-6-7-10-15(3)13(16)12-9-8-11-14(12)2/h12H,4-11H2,1-3H3 |
| InChIKey | JIKHGUNCKNJQNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide?
The IUPAC name of N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide (CID 22897375) is N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide.
What is the SMILES notation for N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide?
The canonical SMILES for N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide is CCCCCCN(C)C(=O)C1CCCN1C.
What is the InChIKey of N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide?
The InChIKey is JIKHGUNCKNJQNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-4-5-6-7-10-15(3)13(16)12-9-8-11-14(12)2/h12H,4-11H2,1-3H3.
What are the key properties of N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide?
N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide has a molecular weight of 226.36 g/mol, XLogP of 2.12, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-N,1-dimethylpyrrolidine-2-carboxamide is sourced from PubChem (CID 22897375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).