C17H22Cl2N2O2 — CID 55609027
N-butyl-1-(3,5-dichlorobenzoyl)-N-methylpyrrolidine-2-carboxamide (PubChem CID 55609027) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is N-butyl-1-(3,5-dichlorobenzoyl)-N-methylpyrrolidine-2-carboxamide.
| Compound Name | N-butyl-1-(3,5-dichlorobenzoyl)-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55609027 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-butyl-1-(3,5-dichlorobenzoyl)-N-methylpyrrolidine-2-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCCN1C(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-3-4-7-20(2)17(23)15-6-5-8-21(15)16(22)12-9-13(18)11-14(19)10-12/h9-11,15H,3-8H2,1-2H3 |
| InChIKey | JZOCPDWKJPZJCZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |