C13H15Cl2N3O2 — CID 60717068
1-(2,6-dichloropyridine-4-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 60717068) has the molecular formula C13H15Cl2N3O2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 1-(2,6-dichloropyridine-4-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-(2,6-dichloropyridine-4-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60717068 |
| Molecular Formula | C13H15Cl2N3O2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-(2,6-dichloropyridine-4-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1C(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O2/c1-17(2)13(20)9-4-3-5-18(9)12(19)8-6-10(14)16-11(15)7-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | MFMILGDZXQLDCK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|