C12H15IN2O2S — CID 78949483
1-(5-iodothiophene-3-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 78949483) has the molecular formula C12H15IN2O2S and a molecular weight of 378.24 g/mol. Its IUPAC name is 1-(5-iodothiophene-3-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-(5-iodothiophene-3-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78949483 |
| Molecular Formula | C12H15IN2O2S |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | 1-(5-iodothiophene-3-carbonyl)-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1C(=O)c1csc(I)c1 |
| InChI | InChI=1S/C12H15IN2O2S/c1-14(2)12(17)9-4-3-5-15(9)11(16)8-6-10(13)18-7-8/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | JRVJOGQQGVWELX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|