C12H18S4 — CID 22897584
1,4-bis(2-methylsulfanylethylsulfanyl)benzene (PubChem CID 22897584) has the molecular formula C12H18S4 and a molecular weight of 290.54 g/mol. Its IUPAC name is 1,4-bis(2-methylsulfanylethylsulfanyl)benzene.
| Compound Name | 1,4-bis(2-methylsulfanylethylsulfanyl)benzene |
|---|---|
| PubChem CID | 22897584 |
| Molecular Formula | C12H18S4 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1,4-bis(2-methylsulfanylethylsulfanyl)benzene |
| SMILES | CSCCSc1ccc(SCCSC)cc1 |
| InChI | InChI=1S/C12H18S4/c1-13-7-9-15-11-3-5-12(6-4-11)16-10-8-14-2/h3-6H,7-10H2,1-2H3 |
| InChIKey | GMIOBZHEAYXJRM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|