C24H38N2O4 — CID 22897608
[4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxyethyl]phenyl] acetate (PubChem CID 22897608) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxyethyl]phenyl] acetate.
| Compound Name | [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxyethyl]phenyl] acetate |
|---|---|
| PubChem CID | 22897608 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | [4-[1-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxyethyl]phenyl] acetate |
| SMILES | CCC1(CC)C(=O)N(C(C)(C)C)CC(C)(C)N1OC(C)c1ccc(OC(C)=O)cc1 |
| InChI | InChI=1S/C24H38N2O4/c1-10-24(11-2)21(28)25(22(5,6)7)16-23(8,9)26(24)30-17(3)19-12-14-20(15-13-19)29-18(4)27/h12-15,17H,10-11,16H2,1-9H3 |
| InChIKey | JAYUUFWTRFTQKC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|