C22H32O8 — CID 22898130
5-[1-[2-(1,3-dioxolan-2-yl)ethoxy]-3-(4-methyl-2,5-dioxooxolan-3-yl)propan-2-yl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 22898130) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is 5-[1-[2-(1,3-dioxolan-2-yl)ethoxy]-3-(4-methyl-2,5-dioxooxolan-3-yl)propan-2-yl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 5-[1-[2-(1,3-dioxolan-2-yl)ethoxy]-3-(4-methyl-2,5-dioxooxolan-3-yl)propan-2-yl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 22898130 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 5-[1-[2-(1,3-dioxolan-2-yl)ethoxy]-3-(4-methyl-2,5-dioxooxolan-3-yl)propan-2-yl]-6-methylbicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CC1C(=O)OC(=O)C1CC(COCCC1OCCO1)C1C2CC(C(=O)O)C(C2)C1C |
| InChI | InChI=1S/C22H32O8/c1-11-15-7-13(8-17(15)20(23)24)19(11)14(9-16-12(2)21(25)30-22(16)26)10-27-4-3-18-28-5-6-29-18/h11-19H,3-10H2,1-2H3,(H,23,24) |
| InChIKey | ZRMOWKPZMPSVMO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|