C19H28O7 — CID 20707335
3-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-2-methylpropanoic acid (PubChem CID 20707335) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-2-methylpropanoic acid.
| Compound Name | 3-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 20707335 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[6-(dimethoxymethyl)-3-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-2-methylpropanoic acid |
| SMILES | COC(OC)C1CC2CC1C(CC(C)C(=O)O)C2C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C19H28O7/c1-8(16(20)21)5-12-11-6-10(7-13(11)19(24-3)25-4)15(12)14-9(2)17(22)26-18(14)23/h8-15,19H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | YFGFOOROLUJZCJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|