C19H29FO5 — CID 21362173
3-[6-[2-(ethoxymethoxy)-2-fluoropropyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione (PubChem CID 21362173) has the molecular formula C19H29FO5 and a molecular weight of 356.43 g/mol. Its IUPAC name is 3-[6-[2-(ethoxymethoxy)-2-fluoropropyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[6-[2-(ethoxymethoxy)-2-fluoropropyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 21362173 |
| Molecular Formula | C19H29FO5 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-[6-[2-(ethoxymethoxy)-2-fluoropropyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
| SMILES | CCOCOC(C)(F)CC1CC2CC1C(C1C(=O)OC(=O)C1C)C2C |
| InChI | InChI=1S/C19H29FO5/c1-5-23-9-24-19(4,20)8-13-6-12-7-14(13)15(10(12)2)16-11(3)17(21)25-18(16)22/h10-16H,5-9H2,1-4H3 |
| InChIKey | XNHJNJOIXFRTHH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|