C20H26F6O5 — CID 23405454
3-[5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione (PubChem CID 23405454) has the molecular formula C20H26F6O5 and a molecular weight of 460.41 g/mol. Its IUPAC name is 3-[5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 23405454 |
| Molecular Formula | C20H26F6O5 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 3-[5-[2-(ethoxymethoxy)-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
| SMILES | CCOCOC(CC1CC2CC1C(C)C2C1C(=O)OC(=O)C1C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H26F6O5/c1-4-29-8-30-18(19(21,22)23,20(24,25)26)7-12-5-11-6-13(12)9(2)14(11)15-10(3)16(27)31-17(15)28/h9-15H,4-8H2,1-3H3 |
| InChIKey | YUPDWZDAAGHVEJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|