C23H30F12O4 — CID 21063568
[2-[3-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5,6-diethyl-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] propanoate (PubChem CID 21063568) has the molecular formula C23H30F12O4 and a molecular weight of 598.47 g/mol. Its IUPAC name is [2-[3-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5,6-diethyl-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] propanoate.
| Compound Name | [2-[3-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5,6-diethyl-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] propanoate |
|---|---|
| PubChem CID | 21063568 |
| Molecular Formula | C23H30F12O4 |
| Molecular Weight | 598.47 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | [2-[3-[2-(ethoxymethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-5,6-diethyl-2-bicyclo[2.2.1]heptanyl]-1,1,1,3,3,3-hexafluoropropan-2-yl] propanoate |
| SMILES | CCOCOC(C1C2CC(C(CC)C2CC)C1C(OC(=O)CC)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H30F12O4/c1-5-11-12(6-2)14-9-13(11)16(18(20(24,25)26,21(27,28)29)38-10-37-8-4)17(14)19(22(30,31)32,23(33,34)35)39-15(36)7-3/h11-14,16-17H,5-10H2,1-4H3 |
| InChIKey | NXDULYYLZCXXRH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.47 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|