C17H23F9O2 — CID 20781752
2-[3-(ethoxymethoxy)-4,4,4-trifluoro-3-(trifluoromethyl)butyl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane (PubChem CID 20781752) has the molecular formula C17H23F9O2 and a molecular weight of 430.35 g/mol. Its IUPAC name is 2-[3-(ethoxymethoxy)-4,4,4-trifluoro-3-(trifluoromethyl)butyl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane.
| Compound Name | 2-[3-(ethoxymethoxy)-4,4,4-trifluoro-3-(trifluoromethyl)butyl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 20781752 |
| Molecular Formula | C17H23F9O2 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-[3-(ethoxymethoxy)-4,4,4-trifluoro-3-(trifluoromethyl)butyl]-2,3,3-trifluoro-5,6-dimethylbicyclo[2.2.1]heptane |
| SMILES | CCOCOC(CCC1(F)C2CC(C(C)C2C)C1(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H23F9O2/c1-4-27-8-28-14(16(21,22)23,17(24,25)26)6-5-13(18)11-7-12(15(13,19)20)10(3)9(11)2/h9-12H,4-8H2,1-3H3 |
| InChIKey | ROZNGBBNJFOHTG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|