C17H24F3O4P — CID 22887509
3-methyl-4-[3-methyl-6-(3,3,3-trifluoro-2-methyl-2-phosphanyloxypropyl)-2-bicyclo[2.2.1]heptanyl]oxolane-2,5-dione (PubChem CID 22887509) has the molecular formula C17H24F3O4P and a molecular weight of 380.34 g/mol. Its IUPAC name is 3-methyl-4-[3-methyl-6-(3,3,3-trifluoro-2-methyl-2-phosphanyloxypropyl)-2-bicyclo[2.2.1]heptanyl]oxolane-2,5-dione.
| Compound Name | 3-methyl-4-[3-methyl-6-(3,3,3-trifluoro-2-methyl-2-phosphanyloxypropyl)-2-bicyclo[2.2.1]heptanyl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 22887509 |
| Molecular Formula | C17H24F3O4P |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 3-methyl-4-[3-methyl-6-(3,3,3-trifluoro-2-methyl-2-phosphanyloxypropyl)-2-bicyclo[2.2.1]heptanyl]oxolane-2,5-dione |
| SMILES | CC1C(=O)OC(=O)C1C1C(C)C2CC(CC(C)(OP)C(F)(F)F)C1C2 |
| InChI | InChI=1S/C17H24F3O4P/c1-7-9-4-10(6-16(3,24-25)17(18,19)20)11(5-9)12(7)13-8(2)14(21)23-15(13)22/h7-13H,4-6,25H2,1-3H3 |
| InChIKey | QXFIHBABYCUDEM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|