C16H24F4O2 — CID 20823633
tert-butyl 6-methyl-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 20823633) has the molecular formula C16H24F4O2 and a molecular weight of 324.36 g/mol. Its IUPAC name is tert-butyl 6-methyl-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-methyl-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 20823633 |
| Molecular Formula | C16H24F4O2 |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl 6-methyl-5-(1,1,2,2-tetrafluoropropyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(CC2C(=O)OC(C)(C)C)C1C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C16H24F4O2/c1-8-10-6-9(12(8)16(19,20)15(5,17)18)7-11(10)13(21)22-14(2,3)4/h8-12H,6-7H2,1-5H3 |
| InChIKey | UWZVQLYDLJUHKR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|