C17H19F11O2 — CID 20771656
[3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 20771656) has the molecular formula C17H19F11O2 and a molecular weight of 464.32 g/mol. Its IUPAC name is [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 20771656 |
| Molecular Formula | C17H19F11O2 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [3,3,4,4,5,6,6,6-octafluoro-5-(trifluoromethyl)hexyl] 5,6-dimethylbicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC1C2CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)C(C2)C1C |
| InChI | InChI=1S/C17H19F11O2/c1-7-8(2)10-5-9(7)6-11(10)12(29)30-4-3-13(18,19)15(21,22)14(20,16(23,24)25)17(26,27)28/h7-11H,3-6H2,1-2H3 |
| InChIKey | RYEGKWOMWXZNDU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|