C19H27F3O5 — CID 23405453
3-[5-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione (PubChem CID 23405453) has the molecular formula C19H27F3O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is 3-[5-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[5-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 23405453 |
| Molecular Formula | C19H27F3O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[5-[2-(ethoxymethoxy)-1,1,1-trifluoropropan-2-yl]-3-methyl-2-bicyclo[2.2.1]heptanyl]-4-methyloxolane-2,5-dione |
| SMILES | CCOCOC(C)(C1CC2CC1C(C)C2C1C(=O)OC(=O)C1C)C(F)(F)F |
| InChI | InChI=1S/C19H27F3O5/c1-5-25-8-26-18(4,19(20,21)22)13-7-11-6-12(13)9(2)14(11)15-10(3)16(23)27-17(15)24/h9-15H,5-8H2,1-4H3 |
| InChIKey | OIYIDLNUJCXMMY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|