C21H32F6O4 — CID 58640835
[8,8,8-trifluoro-7-(2-methoxypropan-2-yloxy)-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58640835) has the molecular formula C21H32F6O4 and a molecular weight of 462.47 g/mol. Its IUPAC name is [8,8,8-trifluoro-7-(2-methoxypropan-2-yloxy)-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | [8,8,8-trifluoro-7-(2-methoxypropan-2-yloxy)-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58640835 |
| Molecular Formula | C21H32F6O4 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [8,8,8-trifluoro-7-(2-methoxypropan-2-yloxy)-7-(trifluoromethyl)octyl] bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(C)(C)OC(CCCCCCOC(=O)C1CC2CCC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C21H32F6O4/c1-18(2,29-3)31-19(20(22,23)24,21(25,26)27)10-6-4-5-7-11-30-17(28)16-13-14-8-9-15(16)12-14/h14-16H,4-13H2,1-3H3 |
| InChIKey | NEZKZEZAKUOTLH-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|