C14H20O3 — CID 22898172
(8-hydroxy-4-methyl-4-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate (PubChem CID 22898172) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (8-hydroxy-4-methyl-4-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate.
| Compound Name | (8-hydroxy-4-methyl-4-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate |
|---|---|
| PubChem CID | 22898172 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (8-hydroxy-4-methyl-4-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(C)CC2C3CC(O)C(C3)C2C1 |
| InChI | InChI=1S/C14H20O3/c1-3-13(16)17-14(2)6-10-8-4-9(11(10)7-14)12(15)5-8/h3,8-12,15H,1,4-7H2,2H3 |
| InChIKey | HABNKMXEZQWPLO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|