About (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate
(4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate (PubChem CID 20736113) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate.
Analyze (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate?
The IUPAC name of (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate (CID 20736113) is (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate.
What is the SMILES notation for (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate?
The canonical SMILES for (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate is CCC1(OC(C)=O)CCC2C3CC(CC3O)C2C1.
What is the InChIKey of (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate?
The InChIKey is MWVIVQDXUVDUIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-3-15(18-9(2)16)5-4-11-12-6-10(7-14(12)17)13(11)8-15/h10-14,17H,3-8H2,1-2H3.
What are the key properties of (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate?
(4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate has a molecular weight of 252.35 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-9-hydroxy-4-tricyclo[6.2.1.02,7]undecanyl) acetate is sourced from PubChem (CID 20736113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).