C14H13ClF4N2O3S — CID 22898333
ethyl 2-[2-chloro-4-fluoro-5-[(2E)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]phenyl]sulfanylpropanoate (PubChem CID 22898333) has the molecular formula C14H13ClF4N2O3S and a molecular weight of 400.78 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-fluoro-5-[(2E)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]phenyl]sulfanylpropanoate.
| Compound Name | ethyl 2-[2-chloro-4-fluoro-5-[(2E)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 22898333 |
| Molecular Formula | C14H13ClF4N2O3S |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | ethyl 2-[2-chloro-4-fluoro-5-[(2E)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]phenyl]sulfanylpropanoate |
| SMILES | CCOC(=O)C(C)Sc1cc(N/N=C/C(=O)C(F)(F)F)c(F)cc1Cl |
| InChI | InChI=1S/C14H13ClF4N2O3S/c1-3-24-13(23)7(2)25-11-5-10(9(16)4-8(11)15)21-20-6-12(22)14(17,18)19/h4-7,21H,3H2,1-2H3/b20-6+ |
| InChIKey | SZKUOPONDXQXHB-CGOBSMCZSA-N |
| XLogP | 4.05 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|