C25H29ClN2O — CID 22899900
4-[[(4-chlorophenyl)diazenyl]methylidene]-2,6-dicyclohexylcyclohexa-2,5-dien-1-one (PubChem CID 22899900) has the molecular formula C25H29ClN2O and a molecular weight of 408.97 g/mol. Its IUPAC name is 4-[[(4-chlorophenyl)diazenyl]methylidene]-2,6-dicyclohexylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[[(4-chlorophenyl)diazenyl]methylidene]-2,6-dicyclohexylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 22899900 |
| Molecular Formula | C25H29ClN2O |
| Molecular Weight | 408.97 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 4-[[(4-chlorophenyl)diazenyl]methylidene]-2,6-dicyclohexylcyclohexa-2,5-dien-1-one |
| SMILES | O=C1C(C2CCCCC2)=CC(=C/N=N/c2ccc(Cl)cc2)C=C1C1CCCCC1 |
| InChI | InChI=1S/C25H29ClN2O/c26-21-11-13-22(14-12-21)28-27-17-18-15-23(19-7-3-1-4-8-19)25(29)24(16-18)20-9-5-2-6-10-20/h11-17,19-20H,1-10H2/b28-27+ |
| InChIKey | LBHOZQRAWJCDNG-BYYHNAKLSA-N |
| XLogP | 7.90 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.97 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|