C15H13ClN2O — CID 20734291
4-[[(3-chlorophenyl)diazenyl]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one (PubChem CID 20734291) has the molecular formula C15H13ClN2O and a molecular weight of 272.74 g/mol. Its IUPAC name is 4-[[(3-chlorophenyl)diazenyl]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one.
| Compound Name | 4-[[(3-chlorophenyl)diazenyl]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 20734291 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 4-[[(3-chlorophenyl)diazenyl]methylidene]-2,6-dimethylcyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=C/N=N/c2cccc(Cl)c2)C=C(C)C1=O |
| InChI | InChI=1S/C15H13ClN2O/c1-10-6-12(7-11(2)15(10)19)9-17-18-14-5-3-4-13(16)8-14/h3-9H,1-2H3/b18-17+ |
| InChIKey | ZEYDUIBERPDYMA-ISLYRVAYSA-N |
| XLogP | 4.78 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|