C19H16N2O — CID 20683540
2,6-dimethyl-4-[(naphthalen-1-yldiazenyl)methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 20683540) has the molecular formula C19H16N2O and a molecular weight of 288.35 g/mol. Its IUPAC name is 2,6-dimethyl-4-[(naphthalen-1-yldiazenyl)methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2,6-dimethyl-4-[(naphthalen-1-yldiazenyl)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 20683540 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2,6-dimethyl-4-[(naphthalen-1-yldiazenyl)methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=C/N=N/c2cccc3ccccc23)C=C(C)C1=O |
| InChI | InChI=1S/C19H16N2O/c1-13-10-15(11-14(2)19(13)22)12-20-21-18-9-5-7-16-6-3-4-8-17(16)18/h3-12H,1-2H3/b21-20+ |
| InChIKey | OKDXKPAXCRUVGV-QZQOTICOSA-N |
| XLogP | 5.28 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|