C31H27N5O6 — CID 22900483
3-[7-(4-carboxyphenyl)-5-[4-(dimethylamino)-2,6-dimethylphenyl]imino-4-methyl-3,6-dioxopyrazolo[3,4-b]pyridin-2-yl]benzoic acid (PubChem CID 22900483) has the molecular formula C31H27N5O6 and a molecular weight of 565.59 g/mol. Its IUPAC name is 3-[7-(4-carboxyphenyl)-5-[4-(dimethylamino)-2,6-dimethylphenyl]imino-4-methyl-3,6-dioxopyrazolo[3,4-b]pyridin-2-yl]benzoic acid.
| Compound Name | 3-[7-(4-carboxyphenyl)-5-[4-(dimethylamino)-2,6-dimethylphenyl]imino-4-methyl-3,6-dioxopyrazolo[3,4-b]pyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 22900483 |
| Molecular Formula | C31H27N5O6 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 3-[7-(4-carboxyphenyl)-5-[4-(dimethylamino)-2,6-dimethylphenyl]imino-4-methyl-3,6-dioxopyrazolo[3,4-b]pyridin-2-yl]benzoic acid |
| SMILES | CC1=C2C(=O)N(c3cccc(C(=O)O)c3)N=C2N(c2ccc(C(=O)O)cc2)C(=O)/C1=N/c1c(C)cc(N(C)C)cc1C |
| InChI | InChI=1S/C31H27N5O6/c1-16-13-23(34(4)5)14-17(2)25(16)32-26-18(3)24-27(35(29(26)38)21-11-9-19(10-12-21)30(39)40)33-36(28(24)37)22-8-6-7-20(15-22)31(41)42/h6-15H,1-5H3,(H,39,40)(H,41,42)/b32-26+ |
| InChIKey | BDVNEJPWWFQCQF-HMZBKAONSA-N |
| XLogP | 4.56 |
| TPSA | 143.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|