C26H28N6O6S — CID 23523646
2-[4-[(4,7-dimethyl-3,6-dioxo-2-phenylpyrazolo[3,4-b]pyridin-5-ylidene)amino]-N-[2-(methanesulfonamido)ethyl]-3-methylanilino]acetic acid (PubChem CID 23523646) has the molecular formula C26H28N6O6S and a molecular weight of 552.61 g/mol. Its IUPAC name is 2-[4-[(4,7-dimethyl-3,6-dioxo-2-phenylpyrazolo[3,4-b]pyridin-5-ylidene)amino]-N-[2-(methanesulfonamido)ethyl]-3-methylanilino]acetic acid.
| Compound Name | 2-[4-[(4,7-dimethyl-3,6-dioxo-2-phenylpyrazolo[3,4-b]pyridin-5-ylidene)amino]-N-[2-(methanesulfonamido)ethyl]-3-methylanilino]acetic acid |
|---|---|
| PubChem CID | 23523646 |
| Molecular Formula | C26H28N6O6S |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 2-[4-[(4,7-dimethyl-3,6-dioxo-2-phenylpyrazolo[3,4-b]pyridin-5-ylidene)amino]-N-[2-(methanesulfonamido)ethyl]-3-methylanilino]acetic acid |
| SMILES | CC1=C2C(=O)N(c3ccccc3)N=C2N(C)C(=O)/C1=N\c1ccc(N(CCNS(C)(=O)=O)CC(=O)O)cc1C |
| InChI | InChI=1S/C26H28N6O6S/c1-16-14-19(31(15-21(33)34)13-12-27-39(4,37)38)10-11-20(16)28-23-17(2)22-24(30(3)26(23)36)29-32(25(22)35)18-8-6-5-7-9-18/h5-11,14,27H,12-13,15H2,1-4H3,(H,33,34)/b28-23- |
| InChIKey | LDLJHFXYXIJOLY-NFFVHWSESA-N |
| XLogP | 1.66 |
| TPSA | 152.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|