C33H37N8NaO6S2 — CID 58776963
sodium 3-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonate (PubChem CID 58776963) has the molecular formula C33H37N8NaO6S2 and a molecular weight of 728.83 g/mol. Its IUPAC name is sodium 3-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonate.
| Compound Name | sodium 3-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 58776963 |
| Molecular Formula | C33H37N8NaO6S2 |
| Molecular Weight | 728.83 g/mol |
| Exact Mass | 728.22 |
| IUPAC Name | sodium 3-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(/N=C2/C(C(C)(C)C)=Nn3nc(-c4ccc(NC(=O)c5cccc(S(=O)(=O)[O-])c5)cc4)nc32)c(C)c1.[Na+] |
| InChI | InChI=1S/C33H38N8O6S2.Na/c1-7-40(18-17-34-48(6,43)44)25-15-16-27(21(2)19-25)36-28-29(33(3,4)5)38-41-31(28)37-30(39-41)22-11-13-24(14-12-22)35-32(42)23-9-8-10-26(20-23)49(45,46)47;/h8-16,19-20,34H,7,17-18H2,1-6H3,(H,35,42)(H,45,46,47);/q;+1/p-1/b36-28-; |
| InChIKey | JAVBYYHHPWCRPY-OCFHSOKSSA-M |
| XLogP | 1.17 |
| TPSA | 191.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.83 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|