C33H38N8O9S3 — CID 58776945
5-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid (PubChem CID 58776945) has the molecular formula C33H38N8O9S3 and a molecular weight of 786.91 g/mol. Its IUPAC name is 5-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid.
| Compound Name | 5-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 58776945 |
| Molecular Formula | C33H38N8O9S3 |
| Molecular Weight | 786.91 g/mol |
| Exact Mass | 786.19 |
| IUPAC Name | 5-[[4-[6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzene-1,3-disulfonic acid |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(/N=C2/C(C(C)(C)C)=Nn3nc(-c4ccc(NC(=O)c5cc(S(=O)(=O)O)cc(S(=O)(=O)O)c5)cc4)nc32)c(C)c1 |
| InChI | InChI=1S/C33H38N8O9S3/c1-7-40(15-14-34-51(6,43)44)24-12-13-27(20(2)16-24)36-28-29(33(3,4)5)38-41-31(28)37-30(39-41)21-8-10-23(11-9-21)35-32(42)22-17-25(52(45,46)47)19-26(18-22)53(48,49)50/h8-13,16-19,34H,7,14-15H2,1-6H3,(H,35,42)(H,45,46,47)(H,48,49,50)/b36-28- |
| InChIKey | CYMLHGIDBPGPNR-DKJXEYTPSA-N |
| XLogP | 3.76 |
| TPSA | 242.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.91 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|