C26H33N8O4S2- — CID 71197480
6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-2-[4-(sulfinatoamino)phenyl]pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 71197480) has the molecular formula C26H33N8O4S2- and a molecular weight of 585.74 g/mol. Its IUPAC name is 6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-2-[4-(sulfinatoamino)phenyl]pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-2-[4-(sulfinatoamino)phenyl]pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 71197480 |
| Molecular Formula | C26H33N8O4S2- |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 6-tert-butyl-7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-2-[4-(sulfinatoamino)phenyl]pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(/N=C2/C(C(C)(C)C)=Nn3nc(-c4ccc(NS(=O)[O-])cc4)nc32)c(C)c1 |
| InChI | InChI=1S/C26H34N8O4S2/c1-7-33(15-14-27-40(6,37)38)20-12-13-21(17(2)16-20)28-22-23(26(3,4)5)30-34-25(22)29-24(31-34)18-8-10-19(11-9-18)32-39(35)36/h8-13,16,27,32H,7,14-15H2,1-6H3,(H,35,36)/p-1/b28-22- |
| InChIKey | PUWGZGUNKGBIAN-SLMZUGIISA-M |
| XLogP | 3.22 |
| TPSA | 157.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|