C43H64N8 — CID 58856849
2-[6-tert-butyl-7-[4-(dioctylamino)-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]-4-N,4-N-diethyl-1-N-ethynylbenzene-1,4-diamine (PubChem CID 58856849) has the molecular formula C43H64N8 and a molecular weight of 693.04 g/mol. Its IUPAC name is 2-[6-tert-butyl-7-[4-(dioctylamino)-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]-4-N,4-N-diethyl-1-N-ethynylbenzene-1,4-diamine.
| Compound Name | 2-[6-tert-butyl-7-[4-(dioctylamino)-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]-4-N,4-N-diethyl-1-N-ethynylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 58856849 |
| Molecular Formula | C43H64N8 |
| Molecular Weight | 693.04 g/mol |
| Exact Mass | 692.53 |
| IUPAC Name | 2-[6-tert-butyl-7-[4-(dioctylamino)-2-methylphenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]-4-N,4-N-diethyl-1-N-ethynylbenzene-1,4-diamine |
| SMILES | C#CNc1ccc(N(CC)CC)cc1-c1nc2n(n1)N=C(C(C)(C)C)/C2=N/c1ccc(N(CCCCCCCC)CCCCCCCC)cc1C |
| InChI | InChI=1S/C43H64N8/c1-10-15-17-19-21-23-29-50(30-24-22-20-18-16-11-2)34-25-27-37(33(6)31-34)45-39-40(43(7,8)9)47-51-42(39)46-41(48-51)36-32-35(49(13-4)14-5)26-28-38(36)44-12-3/h3,25-28,31-32,44H,10-11,13-24,29-30H2,1-2,4-9H3/b45-39- |
| InChIKey | GFIQPGFYBSOMJM-UCJQHMLASA-N |
| XLogP | 11.01 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.04 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|