C51H70N8O2 — CID 90738676
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[6-tert-butyl-7-[4-[butyl(2-cyanoethyl)amino]phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]octanamide (PubChem CID 90738676) has the molecular formula C51H70N8O2 and a molecular weight of 827.17 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[6-tert-butyl-7-[4-[butyl(2-cyanoethyl)amino]phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]octanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[6-tert-butyl-7-[4-[butyl(2-cyanoethyl)amino]phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]octanamide |
|---|---|
| PubChem CID | 90738676 |
| Molecular Formula | C51H70N8O2 |
| Molecular Weight | 827.17 g/mol |
| Exact Mass | 826.56 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[4-[6-tert-butyl-7-[4-[butyl(2-cyanoethyl)amino]phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]octanamide |
| SMILES | CCCCCCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(-c2nc3n(n2)N=C(C(C)(C)C)/C3=N/c2ccc(N(CCC#N)CCCC)cc2)cc1 |
| InChI | InChI=1S/C51H70N8O2/c1-12-16-18-19-21-43(61-42-31-24-37(50(8,9)14-3)35-41(42)51(10,11)15-4)48(60)54-39-25-22-36(23-26-39)46-55-47-44(45(49(5,6)7)56-59(47)57-46)53-38-27-29-40(30-28-38)58(33-17-13-2)34-20-32-52/h22-31,35,43H,12-21,33-34H2,1-11H3,(H,54,60)/b53-44- |
| InChIKey | OETMRCGKYKRBMO-VIVIGYJNSA-N |
| XLogP | 12.58 |
| TPSA | 120.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.17 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|