C37H55N7O4 — CID 58693447
2-[4-[[2-[1-[1-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethoxymethylamino]propan-2-yl]-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-(2-hydroxyethyl)anilino]ethanol (PubChem CID 58693447) has the molecular formula C37H55N7O4 and a molecular weight of 661.89 g/mol. Its IUPAC name is 2-[4-[[2-[1-[1-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethoxymethylamino]propan-2-yl]-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-(2-hydroxyethyl)anilino]ethanol.
| Compound Name | 2-[4-[[2-[1-[1-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethoxymethylamino]propan-2-yl]-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-(2-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 58693447 |
| Molecular Formula | C37H55N7O4 |
| Molecular Weight | 661.89 g/mol |
| Exact Mass | 661.43 |
| IUPAC Name | 2-[4-[[2-[1-[1-[2,4-bis(2-methylbutan-2-yl)phenoxy]ethoxymethylamino]propan-2-yl]-6-methylpyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-(2-hydroxyethyl)anilino]ethanol |
| SMILES | CCC(C)(C)c1ccc(OC(C)OCNCC(C)c2nc3n(n2)N=C(C)/C3=N\c2ccc(N(CCO)CCO)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C37H55N7O4/c1-10-36(6,7)28-12-17-32(31(22-28)37(8,9)11-2)48-27(5)47-24-38-23-25(3)34-40-35-33(26(4)41-44(35)42-34)39-29-13-15-30(16-14-29)43(18-20-45)19-21-46/h12-17,22,25,27,38,45-46H,10-11,18-21,23-24H2,1-9H3/b39-33+ |
| InChIKey | SJUDMBBRWODROA-YQOUJOJOSA-N |
| XLogP | 5.89 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.89 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|