C29H37N7O3 — CID 102010494
N-[2-[7-[4-(diethylamino)phenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]propyl]-4-(4-methoxyphenoxy)butanamide (PubChem CID 102010494) has the molecular formula C29H37N7O3 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-[2-[7-[4-(diethylamino)phenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]propyl]-4-(4-methoxyphenoxy)butanamide.
| Compound Name | N-[2-[7-[4-(diethylamino)phenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]propyl]-4-(4-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 102010494 |
| Molecular Formula | C29H37N7O3 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | N-[2-[7-[4-(diethylamino)phenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]propyl]-4-(4-methoxyphenoxy)butanamide |
| SMILES | CCN(CC)c1ccc(/N=C2\C(C)=Nn3nc(C(C)CNC(=O)CCCOc4ccc(OC)cc4)nc32)cc1 |
| InChI | InChI=1S/C29H37N7O3/c1-6-35(7-2)23-12-10-22(11-13-23)31-27-21(4)33-36-29(27)32-28(34-36)20(3)19-30-26(37)9-8-18-39-25-16-14-24(38-5)15-17-25/h10-17,20H,6-9,18-19H2,1-5H3,(H,30,37)/b31-27+ |
| InChIKey | BRESGYNYWKJLBC-TVKQRKNISA-N |
| XLogP | 4.57 |
| TPSA | 106.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|