C20H32N2O4 — CID 55519495
4-(4-methoxyphenoxy)-N-(3-methyl-2-morpholin-4-ylbutyl)butanamide (PubChem CID 55519495) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-N-(3-methyl-2-morpholin-4-ylbutyl)butanamide.
| Compound Name | 4-(4-methoxyphenoxy)-N-(3-methyl-2-morpholin-4-ylbutyl)butanamide |
|---|---|
| PubChem CID | 55519495 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 4-(4-methoxyphenoxy)-N-(3-methyl-2-morpholin-4-ylbutyl)butanamide |
| SMILES | COc1ccc(OCCCC(=O)NCC(C(C)C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H32N2O4/c1-16(2)19(22-10-13-25-14-11-22)15-21-20(23)5-4-12-26-18-8-6-17(24-3)7-9-18/h6-9,16,19H,4-5,10-15H2,1-3H3,(H,21,23) |
| InChIKey | PQVHADOXROXPKM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|